2-chloro-4-fluorobenzoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

2-chloro-4-fluorobenzoic acid
CAS RN:[2252-51-9]
Formula:C7H4ClFO2; 174.56 g/mol
InChiKey:GRPWQLDSGNZEQE-UHFFFAOYSA-N
SMILES:OC(=O)c1ccc(F)cc1Cl
Molecular structure of 2-chloro-4-fluorobenzoic acid
Melting point:185 °C

Isomers

2-chloro-3-fluorobenzoic acid
Molecular structure of 2-chloro-3-fluorobenzoic acid
2-chloro-4-fluorobenzoic acid
Molecular structure of 2-chloro-4-fluorobenzoic acid
2-chloro-5-fluorobenzoic acid
Molecular structure of 2-chloro-5-fluorobenzoic acid
2-chloro-6-fluorobenzoic acid
Molecular structure of 2-chloro-6-fluorobenzoic acid
3-chloro-2-fluorobenzoic acid
Molecular structure of 3-chloro-2-fluorobenzoic acid
3-chloro-4-fluorobenzoic acid
Molecular structure of 3-chloro-4-fluorobenzoic acid
4-chloro-2-fluorobenzoic acid
Molecular structure of 4-chloro-2-fluorobenzoic acid
4-chloro-3-fluorobenzoic acid
Molecular structure of 4-chloro-3-fluorobenzoic acid
5-chloro-2-fluorobenzoic acid
Molecular structure of 5-chloro-2-fluorobenzoic acid
3-chloro-5-fluoro-4-hydroxybenzaldehyde
Molecular structure of 3-chloro-5-fluoro-4-hydroxybenzaldehyde
3-chloro-5-fluorosalicylaldehyde
Molecular structure of 3-chloro-5-fluorosalicylaldehyde
4-fluorophenyl chloroformate
Molecular structure of 4-fluorophenyl chloroformate
  ::     ::   Zla Mavka